LABOTEST-BB LT00847929 - Names and Identifiers
| Name | 3,4,5-Trimethoxyphenylacetonitrile
|
| Synonyms | LABOTEST-BB LT00847929 3,4,5-trimethoxybenzylnitrile 3,4,5-TRIMETHOXYBENZYL CYANIDE 3,4,5-Trimethoxybenzyl cyanide 3,4,5-trimethoxyphenylacetylnitryl 3,4,5-TRIMETHOXYPHENYLACETONITRILE 3,4,5-Trimethoxyphenylacetonitrile 3,4,5-trimethoxybenzeneacetonitrile 3,4,5-Trimethoxyphenylacetionitrile (3,4,5-trimethoxyphenyl)-acetonitril 3,4,5-TRIMETHOXYPHENYLACETONITRILE (SEE 1942)
|
| CAS | 13338-63-1
|
| EINECS | 236-388-5 |
| InChI | InChI=1/C11H13NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4H2,1-3H3 |
| InChIKey | ACFJNTXCEQCDBX-UHFFFAOYSA-N |
LABOTEST-BB LT00847929 - Physico-chemical Properties
| Molecular Formula | C11H13NO3
|
| Molar Mass | 207.23 |
| Density | 1.1878 (rough estimate) |
| Melting Point | 77-79 °C (lit.) |
| Boling Point | 346.25°C (rough estimate) |
| Flash Point | 132.8°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.000196mmHg at 25°C |
| Appearance | White to light brown fine crystals |
| Color | White to Light yellow |
| Exposure Limit | NIOSH: IDLH 25 mg/m3 |
| BRN | 2214548 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5100 (estimate) |
| MDL | MFCD00001912 |
LABOTEST-BB LT00847929 - Risk and Safety
| Hazard Symbols | Xn - Harmful

|
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed.
R36/37/38 - Irritating to eyes, respiratory system and skin.
|
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36 - Wear suitable protective clothing.
S24/25 - Avoid contact with skin and eyes.
|
| UN IDs | 3276 |
| WGK Germany | 3 |
| RTECS | AM2475000 |
| HS Code | 29269090 |
| Hazard Class | 6.1 |
| Packing Group | III |
LABOTEST-BB LT00847929 - Introduction
3,4, 5-trimethoxybenzeneacetonitrile is a chemical substance, commonly referred to as TMB, and its chemical formula is C10H11NO3. The following is a description of the nature, use, formulation and safety information of TMB:
Nature:
1. Appearance: TMB is white crystal or crystalline powder.
2. Solubility: TMB is insoluble in water, but soluble in organic solvents such as ethanol, dimethylformamide, etc.
3. Melting point: The melting point of TMB is about 75-79°C.
Use:
1. Chemical reagents: TMB is commonly used as a chemical analysis reagent, mainly used to determine the concentration of metal ions and certain organic compounds.
2. Biochemistry: TMB is commonly used as a substrate in the field of biochemistry to detect enzyme activity, etc.
3. Chemical synthesis: TMB can also be used as an important intermediate for the synthesis of other compounds.
Preparation Method:
The preparation method of TMB is relatively simple, and it can usually be prepared by reacting the corresponding phenylacetonitrile compound with chloromethanol. The specific preparation process can refer to the relevant chemical synthesis literature or patent.
Safety Information:
1. TMB is a general chemical and is generally a low-toxic substance.
2. use should be careful to avoid inhalation, chewing or contact with skin and eyes.
3. in the use of the process should pay attention to personal protective measures, such as wearing gloves, to avoid dust and so on.
4. In case of accidental inhalation or exposure, seek medical assistance immediately.
Last Update:2024-04-10 22:29:15